CAS 10394-64-6
:3-IODO-5-NITROANILINE 98
Description:
3-Iodo-5-nitroaniline, with the CAS number 10394-64-6, is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to an aniline structure. This compound typically appears as a solid, often with a yellow to brown coloration, and is known for its moderate solubility in organic solvents while being less soluble in water. The presence of the iodine atom contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the field of pharmaceuticals and agrochemicals. The nitro group enhances its electrophilic properties, allowing it to participate in further chemical reactions, such as nucleophilic substitutions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure, including potential toxicity. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability and integrity. Overall, 3-iodo-5-nitroaniline serves as a valuable intermediate in organic synthesis and research.
Formula:C6H5IN2O2
InChI:InChI=1/C6H5IN2O2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H,8H2
Synonyms:- 3-Iodo-5-Nitro-Anilin
- 3-Iodo-5-nitroaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.