
CAS 103945-18-2
:2,2′:5′,2′′:5′′,2′′′-Quaterthiophene, homopolymer
Description:
2,2′:5′,2′′:5′′,2′′′-Quaterthiophene, homopolymer, identified by CAS number 103945-18-2, is a conjugated polymer composed of repeating units of quaterthiophene, which consists of four thiophene rings linked together. This polymer exhibits notable electronic properties, making it a candidate for applications in organic electronics, such as organic photovoltaics and field-effect transistors. Its structure allows for efficient charge transport due to the extended π-conjugation, which enhances its conductivity and optical properties. The material typically displays a strong absorption in the UV-visible spectrum, contributing to its potential use in light-harvesting applications. Additionally, the polymer's solubility and processability can be influenced by its molecular weight and the presence of substituents, which can be tailored to optimize performance in various applications. Overall, 2,2′:5′,2′′:5′′,2′′′-Quaterthiophene, homopolymer is significant in the field of organic materials due to its unique properties and versatility in electronic applications.
Formula:(C16H10S4)x
InChI:InChI=1S/C16H10S4/c1-3-11(17-9-1)13-5-7-15(19-13)16-8-6-14(20-16)12-4-2-10-18-12/h1-10H
InChI key:InChIKey=FXEJOIFDICYSSO-UHFFFAOYSA-N
SMILES:C=1(SC(=CC1)C2=CC=CS2)C=3SC(=CC3)C4=CC=CS4
Synonyms:- Poly(α-tetrathiophene)
- 2,2′:5′,2′′:5′′,2′′′-Quaterthiophene, homopolymer
- Tetrathiophene homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
