CAS 1039455-85-0
:4-Methyl-1-piperazinecarbothioic acid 2-(9H-cyclopenta[1,2-b:4,3-b′]dipyridin-9-ylidene)hydrazide
Description:
4-Methyl-1-piperazinecarbothioic acid 2-(9H-cyclopenta[1,2-b:4,3-b′]dipyridin-9-ylidene)hydrazide is a complex organic compound characterized by its unique structural features, which include a piperazine ring, a carbothioic acid moiety, and a hydrazide functional group. The presence of the cyclopenta[1,2-b:4,3-b′]dipyridine moiety contributes to its potential biological activity and may influence its solubility and reactivity. This compound likely exhibits properties typical of hydrazides, such as the ability to form hydrogen bonds and participate in various chemical reactions, including condensation and substitution reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Additionally, the compound's stability, reactivity, and solubility in various solvents would be important characteristics to consider in practical applications. Further studies would be necessary to fully elucidate its properties and potential uses in research and industry.
Formula:C17H18N6S
InChI:InChI=1S/C17H18N6S/c1-22-8-10-23(11-9-22)17(24)21-20-16-14-12(4-2-6-18-14)13-5-3-7-19-15(13)16/h2-7H,8-11H2,1H3,(H,21,24)
InChI key:InChIKey=HVAZGKMTSWUWQV-UHFFFAOYSA-N
SMILES:N(NC(=S)N1CCN(C)CC1)=C2C=3C(C=4C2=NC=CC4)=CC=CN3
Synonyms:- 1-Piperazinecarbothioic acid, 4-methyl-, 2-(9H-cyclopenta[1,2-b:4,3-b′]dipyridin-9-ylidene)hydrazide
- COTI 219
- 4-Methyl-1-piperazinecarbothioic acid 2-(9H-cyclopenta[1,2-b:4,3-b′]dipyridin-9-ylidene)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
COTI-219
CAS:COTI-219 is an oral inhibitor of KRAS with antitumor properties [1].Formula:C17H18N6SColor and Shape:SolidMolecular weight:338.43


