CAS 103946-54-9
:4′-Methyl[2,2′-bipyridine]-4-carboxylic acid
Description:
4′-Methyl[2,2′-bipyridine]-4-carboxylic acid, with the CAS number 103946-54-9, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features a methyl group at the 4' position and a carboxylic acid functional group at the 4 position of one of the pyridine rings. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methyl substituent can influence the compound's solubility and reactivity. This substance is often utilized in coordination chemistry, particularly in the synthesis of metal complexes, due to its ability to act as a bidentate ligand. Additionally, its structural features may contribute to its potential applications in materials science and organic synthesis. Overall, 4′-Methyl[2,2′-bipyridine]-4-carboxylic acid is a versatile compound with significant implications in various fields of chemistry.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-8-2-4-13-10(6-8)11-7-9(12(15)16)3-5-14-11/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=LEJWPWXRHHUDRH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N=CC1)C2=CC(C)=CC=N2
Synonyms:- 2-(4-Methylpyridin-2-yl)pyridine-4-carboxylic acid
- 4-Carboxy-4′-methyl-2,2′-bipyridine
- 4′-Methyl-2,2′-bipyridyl-4-carboxylic acid
- [2,2'-Bipyridine]-4-Carboxylic Acid, 4'-Methyl-
- 4′-Methyl-2,2′-bipyridine-4-carboxylic acid
- 4′-Methyl[2,2′-bipyridine]-4-carboxylic acid
- 4-Methyl-2,2′-bipyridine-4′-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4'-Methyl-[2,2'-bipyridine]-4-carboxylic acid
CAS:Formula:C12H10N2O2Purity:98%Color and Shape:SolidMolecular weight:214.22004'-Methyl-[2,2'-bipyridine]-4-carboxylic acid
CAS:4'-Methyl-[2,2'-bipyridine]-4-carboxylic acidPurity:98%Molecular weight:214.224g/mol4-Methyl-4'-carboxy-2,2'-bipyridine
CAS:<p>4-Methyl-4'-carboxy-2,2'-bipyridine is a fluorescent probe that can be used to detect the presence of hydrogen peroxide in cells. It has been shown to bind to mitochondria and liver cells. The binding constants are in the range of 10 M. When exposed to light, 4-methyl-4'-carboxy-2,2'-bipyridine emits an orange fluorescence. This chemical has been used as an oxidation catalyst for amides and as an enhancer for reactive species in kinetic experiments. It also has been shown to have proton uptake properties.</p>Formula:C12H10N2O2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:214.22 g/mol4′-Methyl-[2,2′-bipyridine]-4-carboxylic acid
CAS:Formula:C12H10N2O2Purity:98%Color and Shape:SolidMolecular weight:214.2244'-Methyl-2,2'-bipyridine-4-carboxylic acid
CAS:Controlled Product<p>Applications 4'-Methyl-2,2'-bipyridine-4-carboxylic acid<br></p>Formula:C12H10N2O2Color and Shape:NeatMolecular weight:214.22




