CAS 103956-09-8

3,4-Diaminobenzhydrazide

Description:

3,4-Diaminobenzhydrazide is an organic compound characterized by the presence of two amino groups attached to a benzhydrazide structure. It typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The compound is known for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive molecules. Its structure allows for hydrogen bonding, which can influence its reactivity and interaction with other chemical species. Additionally, 3,4-Diaminobenzhydrazide may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many amine-containing compounds, it should be handled with care to avoid potential health hazards. Overall, its unique chemical properties and structural features make it a valuable compound in both research and industrial applications.

Formula: C₇H₁₀N₄O

InChI: InChI=1/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12)

SMILES: c1cc(c(cc1C(=NN)O)N)N

Synonyms:

• 3,4-Diaminobenzohydrazide

3,4-Diaminobenzohydrazide

CAS: 103956-09-8

Formula: C₇H₁₀N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.1805

Ref: IN-DA007WVO

3,4-Diaminobenzohydrazide

CAS: 103956-09-8

3,4-Diaminobenzohydrazide

Purity: ≥95%

Molecular weight: 166.18g/mol

Ref: 54-OR72079

3,4-Diaminobenzohydrazide

CAS: 103956-09-8

Formula: C₇H₁₀N₄O

Purity: >97.0%(T)(HPLC)

Color and Shape: White to Brown powder to crystal

Molecular weight: 166.18

Ref: 3B-D4551

3,4-Diaminobenzhydrazide

CAS: 103956-09-8

3,4-Diaminobenzhydrazide is a diaminobenzhydrazide compound that is used as an antidote for poisoning by the tick-borne pathogen Ornithodoros moubata. It has been shown to be effective against Ornithodoros infection in humans and can be administered orally or intravenously. 3,4-Diaminobenzhydrazide has a potentiometric titration profile that can be used to detect dysprosium ions in the presence of interfering ions such as chloride. The treatment of Ornithodoros infection does not appear to have any effect on hematology or kidney function.

Formula: C₇H₁₀N₄O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 166.18 g/mol

Ref: 3D-FD70784

3,4-diaminobenzohydrazide

CAS: 103956-09-8

Formula: C₇H₁₀N₄O

Purity: 98%

Color and Shape: Solid, Violet powder

Molecular weight: 166.184

Ref: 10-F366610