CAS 103956-11-2

Benzoic acid, 2-methoxy-4-methyl-, hydrazide

Description:

Benzoic acid, 2-methoxy-4-methyl-, hydrazide, identified by its CAS number 103956-11-2, is an organic compound characterized by the presence of a hydrazide functional group attached to a benzoic acid moiety. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) on the aromatic ring, specifically at the 2 and 4 positions, respectively. The presence of these substituents influences its chemical reactivity and solubility properties. Typically, hydrazides exhibit properties such as the ability to form hydrazones and can participate in various chemical reactions, including condensation and oxidation. The compound may also display biological activity, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as melting point and solubility, can vary based on the specific structure and substituents. Overall, benzoic acid, 2-methoxy-4-methyl-, hydrazide is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1S/C9H12N2O2/c1-6-3-4-7(9(12)11-10)8(5-6)13-2/h3-5H,10H2,1-2H3,(H,11,12)

InChI key: InChIKey=FANPCOOUWUJXAH-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C(OC)C=C(C)C=C1

Synonyms:

• 2-Methoxy-4-methylbenzhydrazide
• 2-Methoxy-4-methylbenzohydrazide
• 2-Methoxy-4-methyl-benzoic acid hydrazide
• Benzoic acid, 2-methoxy-4-methyl-, hydrazide