CAS 10396-80-2
:2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
Description:
2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one, commonly known as a derivative of a phenolic compound, is characterized by its unique structure that includes two tert-butyl groups and a hydroxyl group attached to a cyclohexadienone framework. This compound exhibits antioxidant properties, making it valuable in various applications, particularly in the stabilization of polymers and as a food preservative. Its bulky tert-butyl groups contribute to its hydrophobic nature, enhancing its solubility in non-polar solvents while limiting its solubility in polar solvents. The presence of the hydroxyl group allows for potential hydrogen bonding, which can influence its reactivity and interaction with other substances. Additionally, this compound is known for its thermal stability and resistance to oxidation, which are critical attributes for its use in industrial applications. Overall, 2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one is a significant compound in the field of materials science and chemistry due to its functional properties and versatility.
Formula:C15H24O2
InChI:InChI=1S/C15H24O2/c1-13(2,3)10-8-15(7,17)9-11(12(10)16)14(4,5)6/h8-9,17H,1-7H3
InChI key:InChIKey=DQBHJILNHNRDTM-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C(=O)C(C(C)(C)C)=CC(C)(O)C1
Synonyms:- 2,5-Cyclohexadien-1-one, 2,6-bis(1,1-dimethylethyl)-4-hydroxy-4-methyl-
- 2,5-Cyclohexadien-1-one, 2,6-di-tert-butyl-4-hydroxy-4-methyl-
- 2,6-Bis(1,1-dimethylethyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
- 2,6-Di-Tert-Butyl-4-Hydroxy-4-Methylcyclohexa-2,5-Dien-1-One
- 2,6-Di-t-butyl-4-hydroxy-4-methyl-2,5-cyclohexadienone
- 2,6-Di-tert-butyl-4-hydroxy-4-methyl-2,5-cyclohexadienone
- 2,6-Di-tert-butyl-4-methyl-4-hydroxy-2,5-cyclohexadien-1-one
- 2,6-Ditert-butyl-4-hydroxy-4-methylcyclohexa-2,5-dien-1-one
- 4-Hydroxy-4-methyl-2,6-di-tert-butyl-2,5-cyclohexadienone
- Bht-Oh
- Brn 2050856
- 2,6-Di-tert-butyl-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
CAS:<p>2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one</p>Formula:C15H24O2Purity:98%Color and Shape: white solidMolecular weight:236.35g/mol2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
CAS:Formula:C15H24O2Purity:98%Molecular weight:236.352,6-Di(tert-butyl)-4-Hydroxy-4-Methyl-2,5-cyclohexadien-1-One
CAS:Formula:C15H24O2Molecular weight:236.362,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
CAS:<p>Applications 2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one is a metabolite of BHT (D429480), which acts as an antioxidant.<br>References Bronaugh, R.L. et al.: Tox. Appl. Pharm., 99, 534 (1989);<br></p>Formula:C15H24O2Color and Shape:NeatMolecular weight:236.352,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one
CAS:<p>2,6-Di(tert-butyl)-4-hydroxy-4-methyl-2,5-cyclohexadien-1-one (BHT) is a reactive methide that can be produced by the nucleophilic attack of an electrophile on a molecule containing a methylene group. BHT is used in analytical chemistry as an antioxidant and free radical scavenger. BHT has been shown to protect rat liver microsomes from damage induced by oxidative stress and to inhibit the development of lung cancer in rats chronically treated with cigarette smoke. This product also has been used in modelling studies to study the effect of alveolar type II cells on airway hyperresponsiveness.</p>Formula:C15H24O2Purity:Min. 95%Color and Shape:PowderMolecular weight:236.35 g/mol2,6-Di-tert-butyl-4-hydroxy-4-methylcyclohexa-2,5-dien-1-one
CAS:Purity:98%Color and Shape:SolidMolecular weight:236.3549957
