CAS 103962-05-6
:4-(trifluoromethoxy)iodobenzene
Description:
4-(Trifluoromethoxy)iodobenzene, with the CAS number 103962-05-6, is an organoiodine compound characterized by the presence of an iodine atom and a trifluoromethoxy group attached to a benzene ring. This compound typically exhibits a pale yellow to light brown appearance and is known for its relatively high stability under standard conditions. The trifluoromethoxy group contributes to its unique electronic properties, enhancing its reactivity in nucleophilic substitution reactions. The iodine atom serves as a good leaving group, making it useful in various synthetic applications, particularly in the field of organic synthesis and medicinal chemistry. Additionally, the presence of fluorine atoms can influence the compound's lipophilicity and biological activity. Due to its structural features, 4-(trifluoromethoxy)iodobenzene may also exhibit interesting interactions with biological targets, making it a compound of interest in drug discovery and development. Proper handling and storage are essential, as with many organoiodine compounds, to ensure safety and stability.
Formula:C9H6BrF3O2
InChI:InChI=1/C9H6BrF3O2/c10-5-8(14)6-1-3-7(4-2-6)15-9(11,12)13/h1-4H,5H2
SMILES:c1cc(ccc1C(=O)CBr)OC(F)(F)F
Synonyms:- 1-Iodo-4-(trifluoromethoxy)benzene
- 2-Bromo-1-[4-(Trifluoromethoxy)Phenyl]Ethanone
- 1-Iado-4-(Trifluoromethoxy)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Iodo-4-(trifluoromethoxy)benzene
CAS:Formula:C7H4F3IOPurity:>98.0%(GC)Color and Shape:White to Yellow to Orange clear liquidMolecular weight:288.011-Iodo-4-(trifluoromethoxy)benzene, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H4F3IOPurity:98%Color and Shape:Liquid, Clear yellowMolecular weight:288.011-Iodo-4-(trifluoromethoxy)benzene
CAS:Formula:C7H4F3IOPurity:98%Color and Shape:LiquidMolecular weight:288.00571-Iodo-4-(trifluoromethoxy)benzene
CAS:<p>1-Iodo-4-(trifluoromethoxy)benzene</p>Formula:C7H4F3IOPurity:97%Color and Shape: clear. yellow liquidMolecular weight:288.01g/mol4-(Trifluoromethoxy)iodobenzene
CAS:Formula:C7H4F3IOPurity:97%Color and Shape:Liquid, ClearMolecular weight:288.008




