CymitQuimica logo

CAS 103962-11-4

:

Ethanone, 2-chloro-1-(5-chloro-2-pyridinyl)-

Description:
Ethanone, 2-chloro-1-(5-chloro-2-pyridinyl)-, also known by its CAS number 103962-11-4, is a chemical compound characterized by its structure, which includes a chloro-substituted pyridine ring and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its reactivity and potential applications in organic synthesis. The presence of chlorine atoms in its structure can influence its polarity, solubility, and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the pyridine moiety may impart biological activity, making this compound of interest in medicinal chemistry and agrochemical research. Its synthesis and handling require standard laboratory safety protocols due to the presence of halogenated compounds, which can be hazardous. Overall, this compound represents a unique intersection of organic chemistry and potential practical applications, warranting further investigation into its properties and uses.
Formula:C7H5Cl2NO
InChI:InChI=1S/C7H5Cl2NO/c8-3-7(11)6-2-1-5(9)4-10-6/h1-2,4H,3H2
InChI key:InChIKey=QCPLMMXFHPJCAD-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=CC=C(Cl)C=N1
Synonyms:
  • Ethanone, 2-chloro-1-(5-chloro-2-pyridinyl)-
  • 2-Chloro-1-(5-chloropyridin-2-yl)ethan-1-one
  • 2-Chloro-1-(5-chloropyridin-2-yl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.