CAS 103963-39-9
:Ganoderic acid R
Description:
Ganoderic acid R is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Ganoderic acid R exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in both traditional medicine and modern pharmacology. Its mechanism of action may involve modulation of cellular signaling pathways and inhibition of specific enzymes. Additionally, Ganoderic acid R is known for its ability to enhance immune function, which is a hallmark of many compounds derived from Ganoderma species. The substance is typically studied in the context of herbal medicine and dietary supplements, where it is valued for its health-promoting properties. As with many bioactive compounds, further research is necessary to fully elucidate its therapeutic potential and safety profile in humans.
Formula:C34H50O6
InChI:InChI=1S/C34H50O6/c1-20(30(37)38)10-12-27(39-22(3)35)21(2)24-14-18-34(9)26-11-13-28-31(5,6)29(40-23(4)36)16-17-32(28,7)25(26)15-19-33(24,34)8/h10-11,15,21,24,27-29H,12-14,16-19H2,1-9H3,(H,37,38)/b20-10+/t21-,24+,27-,28-,29+,32+,33+,34-/m0/s1
InChI key:InChIKey=RXLRLJSRXDHQCH-ASNKJFCVSA-N
SMILES:C[C@@]12C=3C([C@@]4(C)[C@](C)(CC3)[C@@]([C@@H]([C@H](C/C=C(/C(O)=O)\C)OC(C)=O)C)(CC4)[H])=CC[C@]1(C(C)(C)[C@H](OC(C)=O)CC2)[H]
Synonyms:- lanosta-7,9(11),24-trien-26-oic acid, 3,22-bis(acetyloxy)-, (3alpha,22S,24E)-
- (3α,22S,24E)-3,22-Bis(acetyloxy)lanosta-7,9(11),24-trien-26-oic acid
- Lanosta-7,9(11),24-trien-26-oic acid, 3,22-bis(acetyloxy)-, (3α,22S,24E)-
- Ganoderic acid R
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ganoderic acid R
CAS:Ganoderic acid R: potent anticancer, induces apoptosis, cytotoxic to MDR and sensitive tumor cells.Formula:C34H50O6Color and Shape:SolidMolecular weight:554.76
