CAS 103963-66-2

N-[1-[1-Methyl-2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenylpropanamide

Description:

N-[1-[1-Methyl-2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenylpropanamide, with CAS number 103963-66-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperidine ring, a thienyl group, and an amide functional group. This compound typically exhibits properties associated with its amide linkage, such as moderate solubility in polar solvents and potential bioactivity due to its ability to interact with biological targets. The presence of the thienyl group may contribute to its pharmacological properties, as thiophene derivatives are often explored for their roles in medicinal chemistry. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals, particularly in areas related to central nervous system activity. Its specific interactions and effects would depend on its conformation and the presence of substituents, which can influence its reactivity and binding affinity to various receptors. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₂₁H₂₈N₂OS

InChI: InChI=1S/C21H28N2OS/c1-3-21(24)23(18-8-5-4-6-9-18)19-11-13-22(14-12-19)17(2)16-20-10-7-15-25-20/h4-10,15,17,19H,3,11-14,16H2,1-2H3

InChI key: InChIKey=YPOXDUYRRSUFFG-UHFFFAOYSA-N

SMILES: N(C(CC)=O)(C1CCN(C(CC2=CC=CS2)C)CC1)C3=CC=CC=C3

Synonyms:

• α-Methylthiofentanyl
• N-[1-[1-Methyl-2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenylpropanamide
• Propanamide, N-[1-[1-methyl-2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenyl-

α-methylthiofentanyl

Controlled Product

CAS: 103963-66-2

Formula: C₂₁H₂₈N₂OS

Color and Shape: Neat

Molecular weight: 356.52

Ref: TR-M330725