CAS 103963-71-9
:2-Hydroxydecanedioic acid
Description:
2-Hydroxydecanedioic acid, also known as 2-hydroxysebacic acid, is a dicarboxylic acid characterized by the presence of two carboxyl (-COOH) groups and a hydroxyl (-OH) group on a decanedioic acid backbone. This compound typically appears as a white crystalline solid and is soluble in water and organic solvents, which enhances its utility in various applications. The hydroxyl group contributes to its potential as a building block in polymer synthesis, particularly in the production of polyesters and polyamides. Additionally, its dicarboxylic nature allows for the formation of esters and amides, making it versatile in chemical reactions. 2-Hydroxydecanedioic acid is of interest in the fields of biochemistry and materials science, where it may be used in the development of biodegradable polymers and other environmentally friendly materials. Its unique structure also suggests potential applications in pharmaceuticals and agrochemicals, although specific uses may vary based on ongoing research and development.
Formula:C10H18O5
InChI:InChI=1S/C10H18O5/c11-8(10(14)15)6-4-2-1-3-5-7-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15)
InChI key:InChIKey=LPIOYESQKJFWPQ-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)O)CCCCCCC(O)=O
Synonyms:- 2-Hydroxysebacic Acid
- Decanedioic acid, 2-hydroxy-
- α-Hydroxysebacic acid
- 2-Hydroxydecanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxydecanedioic Acid
CAS:Controlled ProductFormula:C10H18O5Color and Shape:NeatMolecular weight:218.25
