CAS 10397-16-7
:4,6-Dichloro-N-(1-methylethyl)-2-pyrimidinamine
Description:
4,6-Dichloro-N-(1-methylethyl)-2-pyrimidinamine, with the CAS number 10397-16-7, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 2 and 4 positions. This compound features two chlorine substituents at the 4 and 6 positions of the pyrimidine ring, contributing to its reactivity and potential biological activity. The presence of the isopropyl group (1-methylethyl) at the nitrogen atom enhances its lipophilicity, which can influence its absorption and distribution in biological systems. This compound is often studied for its potential applications in pharmaceuticals, particularly as a herbicide or in other agrochemical formulations, due to its ability to inhibit specific biochemical pathways in plants. Its physical properties, such as solubility and melting point, can vary based on environmental conditions and the presence of other solvents. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C7H9Cl2N3
InChI:InChI=1S/C7H9Cl2N3/c1-4(2)10-7-11-5(8)3-6(9)12-7/h3-4H,1-2H3,(H,10,11,12)
InChI key:InChIKey=FPHWROSQEFDOMM-UHFFFAOYSA-N
SMILES:N(C(C)C)C=1N=C(Cl)C=C(Cl)N1
Synonyms:- 2-Pyrimidinamine, 4,6-dichloro-N-(1-methylethyl)-
- Pyrimidine, 4,6-dichloro-2-(isopropylamino)-
- 4,6-Dichloro-N-isopropylpyrimidin-2-amine
- 4,6-Dichloro-2-(2-propylamino)pyrimidine
- 4,6-Dichloro-N-(1-methylethyl)-2-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
