CymitQuimica logo

CAS 103971-19-3

:

3-Bromo-2-methyl-4-(1-piperidinyl)pyridine

Description:
3-Bromo-2-methyl-4-(1-piperidinyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 4 positions. The presence of a bromine atom at the 3-position and a piperidine group at the 4-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic nature of the pyridine ring and the aliphatic piperidine moiety. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing nature of the bromine atom. Additionally, the piperidine group can influence the compound's biological activity, potentially making it relevant in medicinal chemistry. The compound's solubility is generally influenced by the presence of polar and non-polar functional groups, and it may be soluble in organic solvents. Overall, 3-Bromo-2-methyl-4-(1-piperidinyl)pyridine is of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H15BrN2
InChI:InChI=1S/C11H15BrN2/c1-9-11(12)10(5-6-13-9)14-7-3-2-4-8-14/h5-6H,2-4,7-8H2,1H3
InChI key:InChIKey=FRNWZAKNPBDLLD-UHFFFAOYSA-N
SMILES:BrC=1C(=CC=NC1C)N2CCCCC2
Synonyms:
  • Pyridine, 3-bromo-2-methyl-4-(1-piperidinyl)-
  • 3-Bromo-2-methyl-4-(1-piperidinyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.