CAS 103971-45-5
:5-Bromo-4-(dimethylamino)-2-pyridinemethanol
Description:
5-Bromo-4-(dimethylamino)-2-pyridinemethanol is an organic compound characterized by its pyridine ring structure, which is substituted with a bromine atom and a dimethylamino group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the hydroxymethyl group contributes to its reactivity, allowing for various chemical transformations. Its molecular structure suggests it may exhibit polar characteristics due to the hydroxyl and dimethylamino functionalities, influencing its solubility in polar solvents. Additionally, the bromine substituent can enhance its reactivity in nucleophilic substitution reactions. Safety data sheets should be consulted for handling and storage guidelines, as the compound may pose health risks if not managed properly. Overall, 5-Bromo-4-(dimethylamino)-2-pyridinemethanol is a valuable compound in research and development, particularly in the synthesis of biologically active molecules.
Formula:C8H11BrN2O
InChI:InChI=1S/C8H11BrN2O/c1-11(2)8-3-6(5-12)10-4-7(8)9/h3-4,12H,5H2,1-2H3
InChI key:InChIKey=QMSAAMKZUZLPSH-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C=C(CO)N=CC1Br
Synonyms:- 2-Pyridinemethanol, 5-bromo-4-(dimethylamino)-
- [5-Bromo-4-(dimethylamino)pyridin-2-yl]methanol
- 5-Bromo-4-(dimethylamino)-2-pyridinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
