
CAS 1039741-13-3
:2-Fluorocyclohexanamine
Description:
2-Fluorocyclohexanamine is an organic compound characterized by a cyclohexane ring with an amino group and a fluorine atom attached to the second carbon of the ring. This compound belongs to the class of amines and is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the fluorine atom can influence the compound's biological activity, lipophilicity, and metabolic stability. Typically, 2-fluorocyclohexanamine is a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its molecular structure contributes to its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data sheets indicate that, like many amines, it may be irritating to the skin and eyes, and appropriate handling precautions should be taken. Overall, 2-fluorocyclohexanamine is a compound of interest in both synthetic organic chemistry and pharmaceutical research.
Formula:C6H12FN
InChI:InChI=1S/C6H12FN/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,8H2
InChI key:InChIKey=ZFZUTWAYBJFSIL-UHFFFAOYSA-N
SMILES:FC1C(N)CCCC1
Synonyms:- Cyclohexanamine, 2-fluoro-
- 2-Fluorocyclohexan-1-amine
- 1-Amino-2-fluorocyclohexane
- 2-Fluorocyclohexanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.