CAS 1039766-71-6

Methyl 4,5,6,7-tetrahydro-4-oxo[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylate

Description:

Methyl 4,5,6,7-tetrahydro-4-oxo[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylate is a heterocyclic compound characterized by its complex ring structure, which includes both triazole and pyrazine moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a carboxylate functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of the methyl ester group enhances its lipophilicity, making it more amenable to biological interactions. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the presence of the oxo group may impart specific chemical reactivity, allowing for further derivatization. Overall, this compound exemplifies the diversity of heterocyclic chemistry and its relevance in drug discovery and development.

Formula: C₇H₈N₄O₃

InChI: InChI=1S/C7H8N4O3/c1-14-7(13)4-5-6(12)8-2-3-11(5)10-9-4/h2-3H2,1H3,(H,8,12)

InChI key: InChIKey=FGJUSYZUKBHHFS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2N(N=N1)CCNC2=O

Synonyms:

• [1,2,3]Triazolo[1,5-a]pyrazine-3-carboxylic acid, 4,5,6,7-tetrahydro-4-oxo-, methyl ester
• Methyl 4,5,6,7-tetrahydro-4-oxo[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylate