CAS 103978-24-1

2′-Fluoro-5′-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Fluoro-5′-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2′ position and a nitro group at the 5′ position introduces significant electronic effects, influencing the compound's reactivity and polarity. The carboxylic acid functional group at the 3-position contributes to its acidity and potential for hydrogen bonding, making it soluble in polar solvents. This compound may exhibit interesting properties such as fluorescence or photochemical activity due to its aromatic system and substituents. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (fluoro) groups can affect its electronic distribution, making it a candidate for various chemical reactions, including electrophilic substitutions. Its unique structure and functional groups may also lend it potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and development.

Formula: C₁₃H₈FNO₄

InChI: InChI=1S/C13H8FNO4/c14-12-5-4-10(15(18)19)7-11(12)8-2-1-3-9(6-8)13(16)17/h1-7H,(H,16,17)

InChI key: InChIKey=WTCXPFYKVHTDGH-UHFFFAOYSA-N

SMILES: FC=1C(C2=CC(C(O)=O)=CC=C2)=CC(N(=O)=O)=CC1

Synonyms:

• 2′-Fluoro-5′-nitro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-fluoro-5′-nitro-