CymitQuimica logo

CAS 1039826-29-3

:

(R)-tert-butyl 2-(bromomethyl)pyrrolidine-1-carboxylate

Description:
(R)-tert-butyl 2-(bromomethyl)pyrrolidine-1-carboxylate is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. The bromomethyl substituent introduces a reactive site, allowing for further chemical modifications or reactions, such as nucleophilic substitution. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals. Its chirality, indicated by the (R) configuration, suggests that it may exhibit specific biological activity or selectivity, which is crucial in drug development. The carboxylate functional group contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. Overall, (R)-tert-butyl 2-(bromomethyl)pyrrolidine-1-carboxylate is a versatile intermediate in synthetic organic chemistry, with potential applications in medicinal chemistry and material science.
Formula:C10H18BrNO2
InChI:InChI=1S/C10H18BrNO2/c1-10(2,3)14-9(13)12-6-4-5-8(12)7-11/h8H,4-7H2,1-3H3/t8-/m1/s1
InChI key:OSMADJAEHVCZKN-MRVPVSSYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC[C@@H]1CBr
Found 5 products.