CAS 103986-53-4
:(4-Methyl-1-naphthalene)boronic acid
Description:
(4-Methyl-1-naphthalene)boronic acid, with the CAS number 103986-53-4, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a naphthalene ring that has a methyl substituent at the 4-position. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of boronic acids, such as the ability to form reversible complexes with diols, which makes it useful in various applications, including organic synthesis and materials science. The presence of the naphthalene moiety contributes to its aromatic character, influencing its reactivity and stability. Additionally, (4-Methyl-1-naphthalene)boronic acid can participate in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Its unique structure and reactivity profile make it a subject of interest in both academic research and industrial applications.
Formula:C11H11BO2
InChI:InChI=1/C11H11BO2/c1-8-6-7-11(12(13)14)10-5-3-2-4-9(8)10/h2-7,13-14H,1H3
SMILES:Cc1ccc(c2ccccc12)B(O)O
Synonyms:- 4-Methyl-1-naphthaleneboronic acid
- (4-Methyl-1-naphtalene)boronic acid
- (4-Methylnaphthalen-1-Yl)Boronic Acid
- 4-Methyl-1-naphthyl boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methyl-1-naphthaleneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C11H11BO2Purity:97.0 and le 111.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:186.024-Methylnaphthalene-1-boronic acid, 96%
CAS:<p>Reactant for Suzuki-Miyaura coupling. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part</p>Formula:C11H11BO2Purity:96%Molecular weight:186.024-Methyl-1-naphthaleneboronic acid
CAS:Formula:C11H11BO2Purity:97%Color and Shape:SolidMolecular weight:186.01484-Methylnaphthalene-1-boronic acid
CAS:4-Methylnaphthalene-1-boronic acidPurity:98%Color and Shape:Off-White SolidMolecular weight:186.02g/mol4-Methyl-1-naphthaleneboronic acid
CAS:Formula:C11H11BO2Purity:97%Color and Shape:SolidMolecular weight:186.02




