CymitQuimica logo

CAS 103986-57-8

:

2,3-Dihydro-6-methoxy-3-methyl-1H-inden-1-one

Description:
2,3-Dihydro-6-methoxy-3-methyl-1H-inden-1-one, with the CAS number 103986-57-8, is an organic compound characterized by its unique bicyclic structure, which includes an indene core. This compound features a methoxy group and a methyl group, contributing to its chemical reactivity and potential applications in organic synthesis. It typically exhibits a moderate polarity due to the presence of the methoxy group, influencing its solubility in various organic solvents. The compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, which can be explored for the development of new materials or pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and the presence of other reagents, making it a versatile building block in synthetic organic chemistry. Overall, 2,3-Dihydro-6-methoxy-3-methyl-1H-inden-1-one represents a valuable compound for research and application in various chemical fields.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-7-5-11(12)10-6-8(13-2)3-4-9(7)10/h3-4,6-7H,5H2,1-2H3
InChI key:InChIKey=XITJWOSJNCBUDJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(C)C1)=CC=C(OC)C2
Synonyms:
  • 1-Indanone, 6-methoxy-3-methyl-
  • 2,3-Dihydro-6-methoxy-3-methyl-1H-inden-1-one
  • 1H-Inden-1-one, 2,3-dihydro-6-methoxy-3-methyl-
  • 6-Methoxy-3-methyl-1-indanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.