CAS 103986-73-8

3-Ethoxycinnamic acid

Description:

3-Ethoxycinnamic acid is an organic compound characterized by its structure, which features a cinnamic acid backbone with an ethoxy group attached to the third position of the aromatic ring. This compound typically appears as a white to off-white solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its biological activity and interaction with other substances. 3-Ethoxycinnamic acid may also display UV-absorbing properties, making it of interest in cosmetic formulations as a UV filter. Additionally, it can participate in various chemical reactions, including esterification and polymerization, due to the presence of both carboxylic acid and ethoxy functional groups. Overall, its unique structure and properties make it a compound of interest in both research and industrial applications.

Formula: C₁₁H₁₂O₃

InChI: InChI=1/C11H12O3/c1-2-14-10-5-3-4-9(8-10)6-7-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b7-6+

Synonyms:

• 3-Ethoxycinnamic acid,predominantly trans
• trans-3-Ethoxycinnamic acid
• (2E)-3-(3-ethoxyphenyl)prop-2-enoic acid

Trans-3-Ethoxycinnamic Acid

CAS: 103986-73-8

Formula: C₁₁H₁₂O₃

Purity: 99%

Color and Shape: Solid

Molecular weight: 192.2112

Ref: IN-DA003UXA

3-Ethoxycinnamic acid

CAS: 103986-73-8

Formula: C₁₁H₁₂O₃

Molecular weight: 192.22

Ref: 7W-GK4229

3-Ethoxycinnamic acid

CAS: 103986-73-8

3-Ethoxycinnamic acid is a polyhydric alcohol that has been shown to inhibit the growth of various microorganisms. 3-Ethoxycinnamic acid inhibits the growth of microorganisms by binding to the alkenyl groups in the cell membrane, thereby preventing them from synthesizing their own fatty acids. The binding of 3-ethoxycinnamic acid to alkali metal ions also prevents their uptake into the cell, which leads to an accumulation of these ions outside the cell and eventually results in cell death. 3-Ethoxycinnamic acid is soluble in water and may be used as a stain or quaternary ammonium compound.

Formula: C₁₁H₁₂O₃

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 192.21 g/mol

Ref: 3D-FE70561

(2E)-3-(3-ethoxyphenyl)acrylic acid

CAS: 103986-73-8

Formula: C₁₁H₁₂O₃

Purity: 99%(GC-MS);RG

Molecular weight: 192.214

Ref: 10-F366756