CAS 103986-76-1
:(2E)-3-(2-METHOXY-5-METHYLPHENYL)ACRYLIC ACID
Description:
(2E)-3-(2-Methoxy-5-methylphenyl)acrylic acid, with the CAS number 103986-76-1, is an organic compound characterized by its acrylic acid backbone substituted with a methoxy and a methyl group on a phenyl ring. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The methyl substitution on the phenyl ring can affect the compound's steric hindrance and electronic properties, potentially impacting its biological activity and chemical reactivity. As an acrylic acid derivative, it may participate in various chemical reactions, including polymerization and esterification. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H11O3
InChI:InChI=1/C11H12O3/c1-8-3-5-10(14-2)9(7-8)4-6-11(12)13/h3-7H,1-2H3,(H,12,13)/p-1/b6-4+
Synonyms:- (2E)-3-(2-methoxy-5-methylphenyl)prop-2-enoic acid
- (2E)-3-(2-methoxy-5-methylphenyl)prop-2-enoate
- (2E)-3-(2-methoxy-5-methylphenyl)acrylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.