CAS 10399-13-0: Methyl α-cyclohexyl-α-hydroxybenzeneacetate
Description:Methyl α-cyclohexyl-α-hydroxybenzeneacetate, identified by its CAS number 10399-13-0, is an organic compound characterized by its ester functional group. This substance features a cyclohexyl group and a hydroxybenzene moiety, which contribute to its unique chemical properties. Typically, esters like this compound exhibit moderate polarity due to the presence of both hydrophobic hydrocarbon chains and polar functional groups. This compound may have applications in the fragrance and flavor industry, as esters are often used for their pleasant aromas. Additionally, the presence of the hydroxy group suggests potential for hydrogen bonding, which can influence its solubility in various solvents. The molecular structure indicates that it may possess a degree of stability under standard conditions, although specific reactivity would depend on environmental factors such as temperature and pH. Overall, Methyl α-cyclohexyl-α-hydroxybenzeneacetate is a compound of interest in organic chemistry, particularly in studies related to esters and their derivatives.
Formula:C15H20O3
InChI:InChI=1S/C15H20O3/c1-18-14(16)15(17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2,4-5,8-9,13,17H,3,6-7,10-11H2,1H3
InChI key:InChIKey=SPTZOODMHSABLY-UHFFFAOYSA-N
SMILES:O=C(OC)C(O)(C=1C=CC=CC1)C2CCCCC2
- Synonyms:
- Benzeneacetic acid, α-cyclohexyl-α-hydroxy-, methyl ester
- Cyclohexaneglycolic acid, α-phenyl-, methyl ester
- Methyl 2-Cyclohenyl-2-hydroxy-2-phenylacetate
- Methyl 2-hydroxy-2-cyclohexyl-2-phenylacetate
- Methyl Cyclohexyl(Hydroxy)Phenylacetate
- Methyl alpha-cyclohexylmandelate
- Methyl cyclohexylphenylglycolate
- Methyl α-cyclohexyl-α-hydroxybenzeneacetate
- Methyl α-cyclohexyl-α-phenylglycolate
- Methylcyclohexylphenylglycolate
- See more synonyms
