CymitQuimica logo

CAS 10399-67-4

:

ethyl 5-methoxy-2-nitro-benzoate

Description:
Ethyl 5-methoxy-2-nitrobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methoxy group (-OCH3) and a nitro group (-NO2) attached to the benzene ring, contributing to its chemical reactivity and properties. The presence of the nitro group typically enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Ethyl 5-methoxy-2-nitrobenzoate is generally a pale yellow to light brown liquid or solid, depending on its purity and form. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic aromatic structure. This compound is often utilized in organic synthesis, particularly in the preparation of more complex molecules, and may also serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C10H11NO5
InChI:InChI=1/C10H11NO5/c1-3-16-10(12)8-6-7(15-2)4-5-9(8)11(13)14/h4-6H,3H2,1-2H3
SMILES:CCOC(=O)c1cc(ccc1N(=O)=O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.