CymitQuimica logo

CAS 103994-99-6

:

6,7-Difluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid

Description:
6,7-Difluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a quinoline core with multiple fluorine substituents. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure suggests potential applications in areas such as antimicrobial or antiviral agents, as quinoline derivatives are known for their diverse biological activities. Additionally, the specific arrangement of substituents can affect the compound's solubility, stability, and reactivity, which are critical factors in drug design. Its CAS number, 103994-99-6, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of fluorinated compounds in modern chemistry.
Formula:C16H8F3NO3
InChI:InChI=1S/C16H8F3NO3/c17-8-1-3-9(4-2-8)20-7-11(16(22)23)15(21)10-5-12(18)13(19)6-14(10)20/h1-7H,(H,22,23)
InChI key:InChIKey=RWCWKPZDWFXAFG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CN(C=2C(C1=O)=CC(F)=C(F)C2)C3=CC=C(F)C=C3
Synonyms:
  • 3-Quinolinecarboxylic acid, 6,7-difluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-
  • 6,7-Difluoro-1-(4-fluorophenyl)-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.