CAS 104-01-8: 4-Methoxyphenylacetic acid
Description:4-Methoxyphenylacetic acid, with the CAS number 104-01-8, is an aromatic carboxylic acid characterized by the presence of a methoxy group (-OCH₃) attached to a phenyl ring, which is further connected to an acetic acid moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. It exhibits a melting point that is generally in the moderate range, indicative of its crystalline nature. The methoxy group contributes to its chemical reactivity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and organic synthesis. 4-Methoxyphenylacetic acid can participate in various chemical reactions, such as esterification and amidation, and may serve as an intermediate in the synthesis of more complex organic compounds. Additionally, its derivatives may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry.
Formula:C8H8O3
InChI:InChI=1S/C9H10O3/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11)
InChI key:InChIKey=NRPFNQUDKRYCNX-UHFFFAOYSA-N
SMILES:O=C(O)CC1=CC=C(OC)C=C1
- Synonyms:
- (4-Methoxyphenyl)acetic acid
- (p-Methoxyphenyl)acetic acid
- 2-(4-Methoxyphenyl)acetic acid
- 2-(p-Anisyl)acetic acid
- 2-(p-Methoxyphenyl)acetic acid
- 4-Methoxy Phenylacetic Acid
- 4-MethoxyPhenylAceticAcid
- 4-Methoxybenzeneacetic acid
- 4-Methoxybenzyl Formate
- 4-Methoxyphenacetic acid
- See more synonyms
- 4-Methoxyphenyl Formate
- 4-Methoxyphenylessigsaure
- 4-Mpaa
- Acetic Acid, 4-Methoxyphenyl-
- Acetic acid, (p-methoxyphenyl)-
- Acide 4-methoxyphenylacetique
- Acido 4-Metoxifenilacetico
- Benzeneacetic acid, 4-methoxy-
- Homoanisic acid
- Nsc 27799
- Nsc 65597
- Para methoxy phenyl acetic acid
- p-Anisylacetic acid
- p-Methoxyphenylacetic acid
