CymitQuimica logo

CAS 104-34-7

:

Ethanol, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, 1-(hydrogen sulfate)

Description:
The chemical substance known as Ethanol, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, 1-(hydrogen sulfate), with the CAS number 104-34-7, is a complex organic compound that features a hydrophilic sulfate group and a hydrophobic nonylphenyl moiety. This structure imparts both surfactant properties and potential applications in various formulations, such as detergents and emulsifiers. The presence of multiple ethoxy groups enhances its solubility in water, while the nonylphenyl group contributes to its hydrophobic characteristics, making it effective in reducing surface tension. Ethanol derivatives are often utilized in industrial and laboratory settings due to their ability to interact with both polar and nonpolar substances. Additionally, the sulfate group can provide ionic characteristics, which may influence the compound's reactivity and interaction with other chemical species. Safety considerations should be taken into account, as compounds with nonylphenyl groups can exhibit environmental persistence and potential toxicity. Overall, this compound exemplifies the balance between hydrophilicity and hydrophobicity, making it versatile in various chemical applications.
Formula:C23H40O8S
InChI:InChI=1S/C23H40O8S/c1-2-3-4-5-6-7-8-9-22-10-12-23(13-11-22)30-20-18-28-16-14-27-15-17-29-19-21-31-32(24,25)26/h10-13H,2-9,14-21H2,1H3,(H,24,25,26)
InChI key:InChIKey=JYUQOKPBOVCAMU-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOS(=O)(=O)O)C1=CC=C(CCCCCCCCC)C=C1
Synonyms:
  • Ethanol, 2-[2-[2-[2-(p-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, hydrogen sulfate
  • Ethanol, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, 1-(hydrogen sulfate)
  • Ethanol, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, hydrogen sulfate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.