CAS 104-98-3
:Urocanic acid
Description:
Urocanic acid is an organic compound with the chemical formula C6H6N2O2, classified as an imidazole derivative. It is a colorless to pale yellow crystalline solid that is soluble in water and alcohol. Urocanic acid is primarily found in the skin, where it plays a role in the photoprotection of cells against ultraviolet (UV) radiation. It is formed from the breakdown of histidine, an amino acid, and is involved in various biological processes, including the regulation of immune responses. The compound exhibits a unique property of undergoing tautomerization, existing in both the keto and enol forms, which can influence its reactivity and biological activity. Urocanic acid has been studied for its potential therapeutic applications, particularly in dermatology, due to its ability to absorb UV light and its role in skin health. Additionally, it has been investigated for its effects on immune modulation, making it a subject of interest in research related to skin disorders and cancer.
Formula:C6H6N2O2
InChI:InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)
InChI key:InChIKey=LOIYMIARKYCTBW-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CN=CN1
Synonyms:- (2E)-3-(1H-imidazol-5-yl)prop-2-enoate
- (2E)-3-(1H-imidazol-5-yl)prop-2-enoic acid
- (2Z)-3-(1H-imidazol-5-yl)prop-2-enoic acid
- 2-Propenoic acid, 3-(1H-imidazol-4-yl)-
- 2-Propenoic acid, 3-(1H-imidazol-5-yl)-
- 3-(1H-Imidazol-4-yl)-2-propenoic acid
- 3-(1H-Imidazol-4-yl)acrylic acid
- 3-(1H-Imidazol-5-yl)-2-propenoic acid
- 3-(1H-imidazol-5-yl)prop-2-enoic acid
- 3-(4-Imidazolyl)acrylic acid
- 4-Imidazoleacrylic acid
- 4-Imidazolylacrylic acid
- 5-Imidazoleacrylic acid
- Imidazole-4-acrylic acid
- NSC 66357
- Urocanic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
trans-Urocanic Acid
CAS:Formula:C6H6N2O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:138.13Urocanic acid, 10mM (in DMSO)
CAS:Urocanic acid, 10mM (in DMSO)Purity:≥98%Molecular weight:138.12g/mol3-(1H-imidazol-4-yl)acrylic acid
CAS:3-(1H-imidazol-4-yl)acrylic acidPurity:97%Molecular weight:138.12404g/molUrocanic Acid
CAS:Applications Urocanic acid (cas# 104-98-3) is a useful research chemical.
Formula:C6H6N2O2Color and Shape:White PowderMolecular weight:138.123-(1H-Imidazol-4-yl)acrylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:138.12600708007812Urocanic acid
CAS:Urocanic acid (4-Imidazoleacrylic acid), synthesized in the epidermis, functions as a primary absorber of ultraviolet (UV) radiation in mammalian skin.Formula:C6H6N2O2Purity:99.49% - 99.84%Color and Shape:SolidMolecular weight:138.12Urocanic Acid-13C2d
CAS:Controlled ProductFormula:C4C2H5DN2O2Color and Shape:NeatMolecular weight:141.12Urocanic acid
CAS:Urocanic acid is a naturally occurring skin protectant, which is derived from the amino acid histidine. It is predominantly found in the stratum corneum of the skin, where it plays a crucial role in photoprotection. The mode of action of urocanic acid involves the absorption of ultraviolet (UV) radiation, effectively mitigating the potential damage from UV exposure by dissipating the energy as harmless heat. This UV-filtering capability helps to preserve the structural and functional integrity of skin cells.Formula:C6H6N2O2Purity:Min. 95%Color and Shape:Beige PowderMolecular weight:138.12 g/mol








