CAS 10401-11-3
:3-Hydroxyphenylacetylene
Description:
3-Hydroxyphenylacetylene is an organic compound characterized by the presence of both a hydroxyl group (-OH) and an acetylenic bond (triple bond) in its structure. It features a phenyl ring substituted with a hydroxyl group at the meta position relative to the acetylenic group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in hydrogen bonding and various chemical reactions, such as electrophilic aromatic substitution. Additionally, 3-hydroxyphenylacetylene can exhibit interesting optical properties, making it a candidate for studies in materials science and photonics. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H6O
InChI:InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H
SMILES:C#Cc1cccc(c1)O
Synonyms:- 3-Ethynylphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Ethynylphenol
CAS:Formula:C8H6OPurity:>98.0%(GC)Color and Shape:White or Colorless to Yellow powder to lump to clear liquidMolecular weight:118.143-Hydroxyphenylacetylene, 97%
CAS:3-Hydroxyphenylacetylene is used as a fluorogenic and chromogenic probe for bacterial enzymes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar produ
Formula:C8H6OPurity:97%Color and Shape:Liquid, Clear colorless to yellow or brownMolecular weight:118.143-Hydroxyphenylacetylene
CAS:3-HydroxyphenylacetyleneFormula:C8H6OPurity:98%Color and Shape: light brown liquidMolecular weight:118.13g/mol




