CAS 10401-59-9
:ADAM 9-Anthryldiazomethane
Description:
ADAM, or 9-Anthryldiazomethane, is a chemical compound characterized by its unique structure, which includes an anthracene moiety and a diazo functional group. This compound is typically a yellow to orange solid at room temperature and is known for its photochemical properties, making it useful in various applications, including organic synthesis and materials science. ADAM is often employed as a precursor in the generation of reactive intermediates, particularly in cycloaddition reactions and as a source of singlet oxygen. Its reactivity is attributed to the presence of the diazo group, which can undergo decomposition to form highly reactive species. Additionally, ADAM exhibits fluorescence, which can be harnessed in photophysical studies. Safety considerations are important when handling this compound, as diazo compounds can be hazardous and require appropriate precautions. Overall, ADAM serves as a valuable tool in synthetic organic chemistry and photochemical research due to its distinctive properties and reactivity.
Formula:C15H10N2
InChI:InChI=1/C15H10N2/c16-17-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-10H
SMILES:c1ccc2c(c1)cc1ccccc1c2C=[N+]=[NH-]
Synonyms:- 9-Anthryldiazomethane (ADAM)
- 9-(Diazomethyl)Anthracene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
9-Anthryldiazomethane
CAS:9-Anthryldiazomethane serves as a fluorescent labeling reagent, utilized in the detection of fatty acids and their derivatives [1].Formula:C15H10N2Color and Shape:SolidMolecular weight:218.259-Anthryldiazomethane
CAS:Controlled ProductFormula:C15H10N2Color and Shape:NeatMolecular weight:218.253

