CAS 104012-84-2: O-(D-glucopyranosylidenamino) N-phenyl-carbamate
Description:O-(D-glucopyranosylidenamino) N-phenyl-carbamate, with the CAS number 104012-84-2, is a chemical compound characterized by its unique structural features that combine a glucopyranosyl moiety with a phenyl carbamate group. This compound typically exhibits properties associated with both carbohydrate and aromatic functionalities, which can influence its solubility, reactivity, and biological activity. The glucopyranosyl part contributes to its potential interactions in biological systems, while the phenyl carbamate segment may impart specific chemical reactivity, such as the ability to form hydrogen bonds or participate in nucleophilic substitutions. The presence of the amino group suggests potential for further derivatization or interaction with other biomolecules. Overall, this compound may be of interest in fields such as medicinal chemistry, where glycosylated compounds often exhibit enhanced pharmacological properties, or in materials science for the development of novel polymers or drug delivery systems. Its specific characteristics, including melting point, solubility, and reactivity, would require empirical measurement for precise applications.
Formula:C13H16N2O7
InChI:InChI=1/C13H16N2O7/c16-6-8-9(17)10(18)11(19)12(21-8)15-22-13(20)14-7-4-2-1-3-5-7/h1-5,8-11,16-19H,6H2,(H,14,20)/t8?,9-,10?,11+/m1/s1
- Synonyms:
- O-(D-Glucopyranosylidenamino) N-phenylcarbamate
O-(D-Glucopyranosylidene)amino N-phenylcarbamate
Ref: 3D-MG07449
| 2mg | 195.00 € | ||
| 5mg | 345.00 € | ||
| 10mg | 518.00 € | ||
| 25mg | 1,031.00 € | ||
| 50mg | 1,891.00 € |
O-(D-Glucopyranosylidene)amino N-Phenylcarbamate
Controlled ProductRef: TR-G432000
| 500mg | 9,788.00 € |
