CAS 104018-07-7

Buflomedil pyridoxal phosphate

Description:

Buflomedil pyridoxal phosphate is a chemical compound that serves as a derivative of buflomedil, which is known for its vasodilatory properties. This substance is often studied for its potential therapeutic applications, particularly in enhancing blood flow and improving microcirculation. The pyridoxal phosphate moiety indicates that it is a phosphorylated form of vitamin B6, which plays a crucial role in various enzymatic reactions and metabolic processes. The compound may exhibit neuroprotective effects, making it of interest in research related to neurological disorders. Its mechanism of action is thought to involve modulation of neurotransmitter synthesis and activity. Additionally, the compound's solubility, stability, and bioavailability are important factors that influence its efficacy and application in clinical settings. As with many pharmacologically active substances, understanding its pharmacokinetics and potential side effects is essential for safe and effective use. Overall, buflomedil pyridoxal phosphate represents a unique intersection of vascular and neurological pharmacology.

Formula: C₂₅H₃₅N₂O₁₀P

InChI: InChI=1/C17H25NO4.C8H10NO6P/c1-20-13-11-15(21-2)17(16(12-13)22-3)14(19)7-6-10-18-8-4-5-9-18;1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h11-12H,4-10H2,1-3H3;2-3,11H,4H2,1H3,(H2,12,13,14)

SMILES: COc1cc(c(C(=O)CCCN2CCCC2)c(c1)OC)OC.Cc1c(c(C=O)c(cn1)COP(=O)(O)O)O

Synonyms:

• (4-Formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate 4-pyrrolidin-1-yl-1-(2,4,6-trimethoxyphenyl)butan-1-one
• (4-Formyl-5-Hydroxy-6-Methylpyridin-3-Yl)Methyl Dihydrogen Phosphate - 4-(Pyrrolidin-1-Yl)-1-(2,4,6-Trimethoxyphenyl)Butan-1-One (1:1)
• Buflomedil pyridoxal phosphate