CAS 104019-21-8

7-Acetyl-1,3-dihydro-2H-indol-2-one

Description:

7-Acetyl-1,3-dihydro-2H-indol-2-one, with the CAS number 104019-21-8, is a chemical compound that belongs to the class of indole derivatives. This substance features a bicyclic structure characterized by an indole ring fused with a carbonyl group and an acetyl substituent. It typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its moderate polarity. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, which may include anti-inflammatory and antimicrobial properties. Its molecular structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the presence of the acetyl group can influence its reactivity and interaction with biological targets. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c1-6(12)8-4-2-3-7-5-9(13)11-10(7)8/h2-4H,5H2,1H3,(H,11,13)

InChI key: InChIKey=HZNHRGBBFZXLTD-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C2C(CC(=O)N2)=CC=C1

Synonyms:

• 2H-Indol-2-one, 7-acetyl-1,3-dihydro-
• 7-Acetyloxindole
• 7-Acetyl-1,3-dihydro-2H-indol-2-one