CAS 10402-47-8
:Geranyl valerate
Description:
Geranyl valerate is an ester formed from geraniol and valeric acid. It is characterized by its pleasant floral aroma, which makes it a popular choice in the fragrance and flavor industries. The compound typically appears as a colorless to pale yellow liquid and is known for its low volatility and moderate solubility in organic solvents. Geranyl valerate has a molecular formula that reflects its structure, consisting of a geranyl group linked to a valerate moiety. This compound is often used in perfumery and cosmetic formulations due to its aromatic properties and potential skin-conditioning effects. Additionally, it may exhibit some antimicrobial properties, making it useful in various applications beyond fragrance. As with many esters, geranyl valerate is generally considered to be non-toxic and safe for use in consumer products when used appropriately. However, like all chemicals, it should be handled with care, following safety guidelines to avoid any adverse effects.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-5-6-10-15(16)17-12-11-14(4)9-7-8-13(2)3/h8,11H,5-7,9-10,12H2,1-4H3/b14-11+
InChI key:InChIKey=CVSWGLSBJFKWMW-SDNWHVSQSA-N
SMILES:C(=C/COC(CCCC)=O)(\CCC=C(C)C)/C
Synonyms:- 2,6-Octadien-1-ol, 3,7-dimethyl-, valerate, (E)-
- Pentanoic acid, (2E)-3,7-dimethyl-2,6-octadien-1-yl ester
- Valeric acid, 3,7-dimethyl-2,6-octadienyl ester, (E)-
- Pentanoic acid, 3,7-dimethyl-2,6-octadienyl ester, (E)-
- Pentanoic acid, (2E)-3,7-dimethyl-2,6-octadienyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
