CymitQuimica logo

CAS 104023-75-8

:

2,2-Dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylic acid

Description:
2,2-Dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which is substituted with two chlorine atoms and an ethoxyphenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the dichloro substituents enhances its reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. The ethoxyphenyl group adds to its lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the compound's structural features suggest it may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Its CAS number, 104023-75-8, allows for easy identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, 2,2-Dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylic acid is a compound with distinct chemical characteristics that warrant further investigation for its potential uses.
Formula:C12H12Cl2O3
InChI:InChI=1/C12H12Cl2O3/c1-2-17-9-5-3-8(4-6-9)11(10(15)16)7-12(11,13)14/h3-6H,2,7H2,1H3,(H,15,16)
SMILES:CCOc1ccc(cc1)C1(CC1(Cl)Cl)C(=O)O
Synonyms:
  • 2,2-Dichloro-1-(4'-ethoxyphenyl)cyclopropane-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.