CymitQuimica logo

CAS 1040281-84-2

:

2-(4-Chloro-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(4-Chloro-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a thienyl substituent. The presence of the chloro group on the thienyl moiety enhances its reactivity and potential applications in organic synthesis. This compound is typically used in the field of medicinal chemistry and materials science, particularly in the development of boron-based reagents for cross-coupling reactions, such as Suzuki-Miyaura coupling. Its tetramethyl substitution contributes to its stability and solubility in organic solvents. The dioxaborolane structure is notable for its ability to form stable complexes with various nucleophiles, making it a valuable intermediate in the synthesis of more complex organic molecules. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Overall, this compound exemplifies the versatility of boron compounds in synthetic chemistry.
Formula:C10H14BClO2S
InChI:InChI=1S/C10H14BClO2S/c1-9(2)10(3,4)14-11(13-9)8-5-7(12)6-15-8/h5-6H,1-4H3
InChI key:InChIKey=FQPQQVUHQXLKDP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(Cl)=CS2
Synonyms:
  • 2-(4-Chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-(4-Chloro-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 2-(4-chloro-2-thienyl)-4,4,5,5-tetramethyl-
Found 4 products.