CymitQuimica logo

CAS 1040282-03-8

:

2-(2-Bromo-5-chloro-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(2-Bromo-5-chloro-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a thienyl substituent. The presence of bromine and chlorine atoms in the thienyl group contributes to its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions. The tetramethyl substituents on the dioxaborolane enhance its stability and solubility in organic solvents, making it suitable for various chemical transformations. This compound is of interest in the field of medicinal chemistry and materials science due to its potential role as a building block in the synthesis of more complex molecules. Its specific reactivity can be influenced by the electronic effects of the halogen substituents, which may affect the compound's behavior in reactions such as Suzuki coupling. Overall, this compound exemplifies the versatility of boron-containing compounds in organic synthesis and their importance in developing new materials and pharmaceuticals.
Formula:C10H13BBrClO2S
InChI:InChI=1S/C10H13BBrClO2S/c1-9(2)10(3,4)15-11(14-9)6-5-7(13)16-8(6)12/h5H,1-4H3
InChI key:InChIKey=VBMBMKPNZMVHKE-UHFFFAOYSA-N
SMILES:BrC1=C(C=C(Cl)S1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 1,3,2-Dioxaborolane, 2-(2-bromo-5-chloro-3-thienyl)-4,4,5,5-tetramethyl-
  • 2-(2-Bromo-5-chloro-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.