CAS 10403-00-6

(3R)-3-methylcyclopentadecanone

Description:

(3R)-3-methylcyclopentadecanone, with the CAS number 10403-00-6, is a cyclic ketone characterized by its unique structure, which includes a cyclopentadecane ring with a methyl group and a ketone functional group at the 3-position. This compound is typically colorless to pale yellow in appearance and possesses a distinctive odor, often described as waxy or fatty. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the ketone group contributes to its reactivity, allowing it to participate in various chemical reactions, such as oxidation and reduction. Additionally, (3R)-3-methylcyclopentadecanone may exhibit biological activity, making it of interest in fragrance and flavor industries, as well as in potential pharmaceutical applications. Its stereochemistry, indicated by the (3R) designation, suggests specific spatial arrangements of its atoms, which can influence its chemical behavior and interactions with other molecules. Overall, this compound is notable for its structural complexity and potential applications in various fields.

Formula: C₁₆H₃₀O

InChI: InChI=1/C16H30O/c1-15-12-10-8-6-4-2-3-5-7-9-11-13-16(17)14-15/h15H,2-14H2,1H3/t15-/m1/s1

SMILES: C[C@@H]1CCCCCCCCCCCCC(=O)C1

Synonyms:

• cyclopentadecanone, 3-methyl-, (3R)-
• (3R)-3-Methylcyclopentadecanone

(R)-3-Methylcyclopentadecan-1-one

CAS: 10403-00-6

(R)-3-Methylcyclopentadecan-1-one

Purity: 98%

Molecular weight: 238.41g/mol

Ref: 54-OR1001727

(R)-Muscone

Controlled Product

CAS: 10403-00-6

Applications (R)-Muscone is a chemical compound that protects PC12 cells against glutamate-induced apoptosis. In addition, its a primary contributor to the odour of musk.
References Yu, L., et. al.: Neurochem. Int., 70, 10 (2014)

Formula: C₁₆H₃₀O

Color and Shape: Neat

Molecular weight: 238.41

Ref: TR-M815093