CAS 1040377-11-4: 4-Bromo-1-[(tetrahydro-2H-pyran-4-yl)methyl]-1H-pyrazole
Description:4-Bromo-1-[(tetrahydro-2H-pyran-4-yl)methyl]-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a bromine substituent. The presence of the tetrahydro-2H-pyran moiety contributes to its potential as a versatile building block in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential reactivity due to the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the pyrazole ring is known for its biological activity, making this compound of interest in medicinal chemistry. The presence of the tetrahydro-2H-pyran group may also influence its pharmacokinetic properties, such as stability and permeability. Overall, 4-Bromo-1-[(tetrahydro-2H-pyran-4-yl)methyl]-1H-pyrazole represents a compound with potential applications in drug development and organic synthesis, warranting further investigation into its properties and reactivity.
Formula:C9H13BrN2O
InChI:InChI=1S/C9H13BrN2O/c10-9-5-11-12(7-9)6-8-1-3-13-4-2-8/h5,7-8H,1-4,6H2
InChI key:InChIKey=AXZFAXKHZJWQPA-UHFFFAOYSA-N
SMILES:BrC=1C=NN(C1)CC2CCOCC2
- Synonyms:
- 1H-Pyrazole, 4-bromo-1-[(tetrahydro-2H-pyran-4-yl)methyl]-
- 4-Bromo-1-[(tetrahydro-2H-pyran-4-yl)methyl]-1H-pyrazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Bromo-1-((tetrahydro-2H-pyran-4-yl)methyl)-1H-pyrazole REF: 3D-QRB37711CAS: 1040377-11-4 | Min. 95% | - - - | Discontinued product |

4-Bromo-1-((tetrahydro-2H-pyran-4-yl)methyl)-1H-pyrazole
Ref: 3D-QRB37711
1g | Discontinued | Request information |