CAS 1040400-88-1

B-[2-Amino-4-(aminocarbonyl)phenyl]boronic acid

Description:

B-[2-Amino-4-(aminocarbonyl)phenyl]boronic acid, with the CAS number 1040400-88-1, is a boronic acid derivative characterized by the presence of both amino and carbonyl functional groups attached to a phenyl ring. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The amino groups contribute to its potential as a ligand in coordination chemistry and its reactivity in coupling reactions, such as Suzuki cross-coupling. Additionally, the presence of the boron atom allows for unique interactions in biological systems, which can be exploited for drug development. The compound is likely to be soluble in polar solvents, and its stability can be influenced by pH and the presence of other functional groups. Overall, B-[2-Amino-4-(aminocarbonyl)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and biological chemistry.

Formula: C₇H₉BN₂O₃

InChI: InChI=1S/C7H9BN2O3/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,12-13H,9H2,(H2,10,11)

InChI key: InChIKey=OXDIYMNQYJTIQC-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC(N)=C(B(O)O)C=C1

Synonyms:

• (2-Amino-4-carbamoylphenyl)boronic acid
• B-[2-Amino-4-(aminocarbonyl)phenyl]boronic acid
• Boronic acid, B-[2-amino-4-(aminocarbonyl)phenyl]-