
CAS 10405-07-9
:(2S)-2-Amino-1,4-butanediol
Description:
(2S)-2-Amino-1,4-butanediol, also known as L-threo-2-amino-1,4-butanediol, is an organic compound characterized by its amino alcohol structure. It features a four-carbon backbone with two hydroxyl (-OH) groups and an amino (-NH2) group, making it a chiral molecule with specific stereochemistry. This compound is typically a white crystalline solid and is soluble in water due to the presence of hydroxyl groups, which can form hydrogen bonds with water molecules. It is often used in biochemical research and has potential applications in pharmaceuticals, particularly in the synthesis of various bioactive compounds. The presence of both amino and hydroxyl functional groups allows it to participate in a range of chemical reactions, including those involving peptide bond formation. Additionally, (2S)-2-amino-1,4-butanediol can serve as a building block in the synthesis of more complex molecules, contributing to its significance in organic and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C4H11NO2
InChI:InChI=1S/C4H11NO2/c5-4(3-7)1-2-6/h4,6-7H,1-3,5H2/t4-/m0/s1
InChI key:InChIKey=PYBVXNWDSBYQSA-BYPYZUCNSA-N
SMILES:[C@H](CCO)(CO)N
Synonyms:- 1,4-Butanediol, 2-amino-, L-(-)-
- 1,4-Butanediol, 2-amino-, (S)-
- (2S)-2-Amino-1,4-butanediol
- (S)-2-Aminobutane-1,4-diol
- 1,4-Butanediol, 2-amino-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.