CAS 104053-89-6

N-[2-(4-Chlorophenoxy)ethyl]acetamide

Description:

N-[2-(4-Chlorophenoxy)ethyl]acetamide, with the CAS number 104053-89-6, is a chemical compound characterized by its acetamide functional group and a chlorophenoxy substituent. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. The presence of the 4-chlorophenoxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound's structure suggests it may interact with various biological targets, potentially influencing processes such as enzyme activity or receptor binding. Its synthesis generally involves the reaction of 4-chlorophenol with an appropriate ethylene derivative, followed by acetylation. Safety data indicate that, like many organic compounds, it should be handled with care, as it may pose risks such as skin irritation or toxicity upon exposure. Overall, N-[2-(4-Chlorophenoxy)ethyl]acetamide represents a class of compounds that may have applications in medicinal chemistry and agrochemicals, warranting further investigation into its properties and effects.

Formula: C₁₀H₁₂ClNO₂

InChI: InChI=1S/C10H12ClNO2/c1-8(13)12-6-7-14-10-4-2-9(11)3-5-10/h2-5H,6-7H2,1H3,(H,12,13)

InChI key: InChIKey=FEGSIXOPPFWXRU-UHFFFAOYSA-N

SMILES: O(CCNC(C)=O)C1=CC=C(Cl)C=C1

Synonyms:

• Acetamide, N-[2-(4-chlorophenoxy)ethyl]-
• N-[2-(4-Chlorophenoxy)ethyl]acetamide