CAS 10406-05-0

5-Chloroindole-3-carboxylic acid

Description:

5-Chloroindole-3-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 5-position and a carboxylic acid group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It exhibits acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. 5-Chloroindole-3-carboxylic acid is of interest in medicinal chemistry and research, particularly for its potential biological activities, including antimicrobial and anti-inflammatory properties. Its structural features make it a valuable building block in the synthesis of more complex molecules, especially in the development of pharmaceuticals. As with many chemical substances, proper handling and safety precautions are essential due to its potential reactivity and biological effects.

Formula: C₉H₆ClNO₂

InChI: InChI=1/C9H6ClNO2/c10-5-1-2-8-6(3-5)7(4-11-8)9(12)13/h1-4,11H,(H,12,13)

SMILES: c1cc2c(cc1Cl)c(c[nH]2)C(=O)O

Synonyms:

• 5-chloro-1H-indole-3-carboxylic acid
• Rarechem Al Be 0763

5-Chloro-1H-indole-3-carboxylic acid

CAS: 10406-05-0

Formula: C₉H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.6024

Ref: IN-DA007F28

5-Chloroindole-3-carboxylic acid

CAS: 10406-05-0

5-Chloroindole-3-carboxylic acid

Purity: 98%

Molecular weight: 195.60g/mol

Ref: 54-OR480765

5-Chloroindole-3-carboxylic acid

CAS: 10406-05-0

5-Chloroindole-3-Carboxylic Acid is a ring system that is a dimer of two indole rings and one carboxyl group. It has the ability to form hydrogen bonds with itself, which allows it to stack together in an orderly manner. The carboxyl group on the 5-chloroindole-3-carboxylic acid molecule can form hydrogen bonds with water molecules due to its electronegativity. This property enables 5-chloroindole-3-carboxylic acid molecules to be soluble in water, which is why it is used for water treatment and as a corrosion inhibitor.

Formula: C₉H₆ClNO₂

Purity: Min. 95%

Molecular weight: 195.6 g/mol

Ref: 3D-FC56780

5-Chloroindole-3-carboxylic acid

CAS: 10406-05-0

5-Chloroindole-3-carboxylic acid is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It is used as a reagent, speciality chemical and as a reaction component. 5-Chloroindole-3-carboxylic acid has been shown to be useful in the synthesis of pharmaceuticals and other organic molecules. This compound can also be used as a scaffold for creating new structures with the same core structure. The compound has CAS No. 10406-05-0 and is high quality with low impurities.

Formula: C₉H₆ClNO₂

Molecular weight: 195.61 g/mol

Ref: 3D-C-4525

5-Chloro-1H-indole-3-carboxylic acid

CAS: 10406-05-0

Formula: C₉H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 195.6

Ref: 10-F040487