CAS 10406-06-1: 5-Bromo-1H-indole-3-carboxylic acid
Description:5-Bromo-1H-indole-3-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position and a carboxylic acid group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. It exhibits acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. The bromine substituent can also serve as a site for further functionalization, making it a valuable intermediate in organic synthesis and medicinal chemistry. Additionally, compounds like 5-Bromo-1H-indole-3-carboxylic acid are of interest in biological research due to their potential pharmacological activities, including antimicrobial and anticancer properties.
Formula:C9H6BrNO2
InChI:InChI=1S/C9H6BrNO2/c10-5-1-2-8-6(3-5)7(4-11-8)9(12)13/h1-4,11H,(H,12,13)
InChI key:InChIKey=JVZMBSGNSAHFCY-UHFFFAOYSA-N
SMILES:O=C(O)C1=CNC=2C=CC(Br)=CC21
- Synonyms:
- 1H-Indole-3-carboxylic acid, 5-bromo-
- 5-Bromoindole-3-Carboxylic Acid
- Indole-3-carboxylic acid, 5-bromo-
- Rarechem Al Be 0374
- 5-Bromo-1H-indole-3-carboxylic acid

5-Bromoindole-3-carboxylic Acid
Ref: 3B-B4790
1g | 83.00 € | ||
5g | 377.00 € |

5-Bromo-1H-indole-3-carboxylic acid
Ref: IN-DA003MFM
1g | 26.00 € | ||
5g | 47.00 € | ||
10g | 74.00 € | ||
25g | 133.00 € | ||
100g | 337.00 € | ||
250mg | 22.00 € |

Ref: 54-OR480712
1g | 36.00 € | ||
5g | 44.00 € | ||
25g | 146.00 € | ||
100g | 396.00 € | ||
500g | 1,757.00 € | ||
250mg | 32.00 € |

5-Bromo-indole-3-carboxylic acid
Ref: 10-F037073
1g | To inquire | ||
5g | 27.00 € | ||
10g | 51.00 € | ||
25g | 117.00 € | ||
100g | To inquire |

5-Bromo-1H-indole-3-carboxylic acid
Ref: 3D-FB33252
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |