CAS 104060-23-3

tert-butyl [4-(2-hydroxyethyl)phenyl]carbamate

Description:

Tert-butyl [4-(2-hydroxyethyl)phenyl]carbamate, with the CAS number 104060-23-3, is an organic compound characterized by its carbamate functional group. It features a tert-butyl group, which contributes to its hydrophobic properties, and a phenyl ring substituted with a hydroxyethyl group, enhancing its solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential applications in drug formulation due to the presence of the hydroxyethyl moiety, which can participate in hydrogen bonding and improve interactions with biological targets. The stability of the tert-butyl group can also influence the reactivity of the compound, making it a valuable building block in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, tert-butyl [4-(2-hydroxyethyl)phenyl]carbamate is a versatile compound with significant implications in various chemical applications.

Formula: C₁₃H₁₉NO₃

InChI: InChI=1/C13H19NO3/c1-13(2,3)17-12(16)14-11-6-4-10(5-7-11)8-9-15/h4-7,15H,8-9H2,1-3H3,(H,14,16)

SMILES: CC(C)(C)OC(=O)Nc1ccc(cc1)CCO

N-Boc-2-(4-Aminophenyl)ethanol

CAS: 104060-23-3

Formula: C₁₃H₁₉NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 237.2949

Ref: IN-DA00854Z

N-Boc-2-(4-Aminophenyl)Ethanol

CAS: 104060-23-3

N-Boc-2-(4-Aminophenyl)Ethanol

Purity: 98%

Molecular weight: 237.3g/mol

Ref: 54-OR1030410

N-Boc-2-(4-Aminophenyl)ethanol

CAS: 104060-23-3

Formula: C₁₃H₁₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.299

Ref: 10-F078808