CAS 104060-25-5

1-(2-Bromoethyl)-4-(methoxymethyl)benzene

Description:

1-(2-Bromoethyl)-4-(methoxymethyl)benzene, with the CAS number 104060-25-5, is an organic compound characterized by its aromatic structure, featuring a bromine atom and a methoxymethyl group attached to a benzene ring. The presence of the bromine atom introduces reactivity, making it a potential candidate for nucleophilic substitution reactions. The methoxymethyl group enhances the compound's solubility in organic solvents and may influence its electronic properties. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, due to its functional groups that can participate in various chemical reactions. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of the bromine and methoxy groups. Safety data should be consulted, as the bromine atom can pose hazards, and appropriate handling and storage conditions are necessary to mitigate risks associated with its use.

Formula: C₁₀H₁₃BrO

InChI: InChI=1S/C10H13BrO/c1-12-8-10-4-2-9(3-5-10)6-7-11/h2-5H,6-8H2,1H3

InChI key: InChIKey=ZOXGGJAWWUDXSB-UHFFFAOYSA-N

SMILES: C(CBr)C1=CC=C(COC)C=C1

Synonyms:

• Benzene, 1-(2-bromoethyl)-4-(methoxymethyl)-
• 1-(2-Bromoethyl)-4-(methoxymethyl)benzene