CAS 104065-95-4

2-(2-methylpropoxy)aniline

Description:

2-(2-Methylpropoxy)aniline, with the CAS number 104065-95-4, is an organic compound characterized by the presence of an aniline group (an amino-substituted aromatic ring) and a 2-methylpropoxy substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its moderate solubility in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the aromatic ring and the alkyl chain. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as electrophilic aromatic substitution and nucleophilic reactions. Additionally, 2-(2-methylpropoxy)aniline may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling, as it may pose health risks if inhaled, ingested, or in contact with skin. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-8(2)7-12-10-6-4-3-5-9(10)11/h3-6,8H,7,11H2,1-2H3

SMILES: CC(C)COc1ccccc1N

2-Isobutoxyaniline

CAS: 104065-95-4

2-Isobutoxyaniline

Purity: ≥90%

Molecular weight: 165.23g/mol

Ref: 54-BUP02300

2-Isobutoxyaniline

CAS: 104065-95-4

2-Isobutoxyaniline ((2-isobutoxyphenyl)amine) is a marine derived natural products found in Brevibacterium sp.

Formula: C₁₀H₁₅NO

Purity: 96.84% - 99.82%

Color and Shape: Solid

Molecular weight: 165.23

Ref: TM-TN7137

(2-isobutoxyphenyl)amine

CAS: 104065-95-4

Formula: C₁₀H₁₅NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 165.236

Ref: 10-F309716

2-(2-Methylpropoxy)aniline

CAS: 104065-95-4

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-EEA06595