CAS 1040662-77-8

6-Chloro-N-(3,4-dimethylphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

6-Chloro-N-(3,4-dimethylphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a chloro substituent at the 6-position and an N-(3,4-dimethylphenyl) group, contributing to its potential biological activity. The presence of the methyl group at the 1-position of the pyrazolo ring enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, possibly targeting specific biological pathways or receptors. Its molecular structure suggests it may exhibit unique interactions with biological macromolecules, making it a candidate for further research in therapeutic contexts. As with many such compounds, understanding its solubility, stability, and reactivity is crucial for evaluating its practical applications in pharmaceuticals or agrochemicals. Safety and handling considerations are also important, given the presence of chlorine and the potential for biological activity.

Formula: C₁₄H₁₄ClN₅

InChI: InChI=1S/C14H14ClN5/c1-8-4-5-10(6-9(8)2)17-12-11-7-16-20(3)13(11)19-14(15)18-12/h4-7H,1-3H3,(H,17,18,19)

InChI key: InChIKey=OWNAKPDKZWOIKU-UHFFFAOYSA-N

SMILES: N(C1=C2C(=NC(Cl)=N1)N(C)N=C2)C3=CC(C)=C(C)C=C3

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 6-chloro-N-(3,4-dimethylphenyl)-1-methyl-
• 6-Chloro-N-(3,4-dimethylphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

6-Chloro-N-(3,4-dimethylphenyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 1040662-77-8

Purity: 95.0%

Molecular weight: 287.75

Ref: 10-F520754