
CAS 1040686-37-0
:3-(2-Methoxyethoxy)-N-[2-(3-methylphenoxy)propyl]benzenamine
Description:
3-(2-Methoxyethoxy)-N-[2-(3-methylphenoxy)propyl]benzenamine, with the CAS number 1040686-37-0, is a chemical compound characterized by its complex structure that includes a benzene ring substituted with an amine group and various ether and phenyl functionalities. This compound features a methoxyethoxy group, which enhances its solubility in organic solvents and may influence its biological activity. The presence of the 3-methylphenoxy group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as moderate lipophilicity, which can affect its pharmacokinetics and bioavailability. Additionally, the amine functionality may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, this compound's unique characteristics make it a candidate for further investigation in fields such as drug development and materials science. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C19H25NO3
InChI:InChI=1S/C19H25NO3/c1-15-6-4-9-19(12-15)23-16(2)14-20-17-7-5-8-18(13-17)22-11-10-21-3/h4-9,12-13,16,20H,10-11,14H2,1-3H3
InChI key:InChIKey=FWULYIRIPBQKEO-UHFFFAOYSA-N
SMILES:N(CC(OC1=CC(C)=CC=C1)C)C2=CC(OCCOC)=CC=C2
Synonyms:- 3-(2-Methoxyethoxy)-N-[2-(3-methylphenoxy)propyl]benzenamine
- Benzenamine, 3-(2-methoxyethoxy)-N-[2-(3-methylphenoxy)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.